
CAS 1461-27-4
:Sylvestrene
Description:
Sylvestrene, with the CAS number 1461-27-4, is a naturally occurring organic compound classified as a monoterpene. It is primarily derived from various plant sources, particularly coniferous trees. Sylvestrene is characterized by its bicyclic structure, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid with a pleasant, pine-like aroma, making it of interest in the fragrance and flavor industries. The compound is known for its reactivity, particularly in polymerization reactions, where it can serve as a monomer in the synthesis of various polymers. Additionally, sylvestrene exhibits some biological activity, which has led to studies exploring its potential applications in pharmaceuticals and agrochemicals. Its solubility in organic solvents and low volatility are also notable characteristics, influencing its behavior in different chemical environments. Overall, sylvestrene's unique structure and properties make it a compound of interest in both industrial and research contexts.
Formula:C10H16
InChI:InChI=1S/C10H16/c1-8(2)10-6-4-5-9(3)7-10/h5,10H,1,4,6-7H2,2-3H3/t10-/m1/s1
InChI key:InChIKey=JWQKMEKSFPNAIB-SNVBAGLBSA-N
SMILES:C(C)(=C)[C@H]1CC(C)=CCC1
Synonyms:- m-Mentha-6,8-diene, (R)-(+)-
- Sylvestrene
- Cyclohexene, 1-methyl-5-(1-methylethenyl)-, (R)-
- Cyclohexene, 1-methyl-5-(1-methylethenyl)-, (5R)-
- (5R)-1-Methyl-5-(1-methylethenyl)cyclohexene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
