
CAS 146117-78-4
:trans-(±)-8-Chloro-4-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinolin-3-one
Description:
Trans-(±)-8-Chloro-4-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinolin-3-one is a chemical compound characterized by its complex bicyclic structure, which includes a chloro substituent and a methyl group. This compound belongs to the class of quinolines, which are known for their diverse biological activities. The presence of the chloro group can influence its reactivity and interaction with biological targets. The octahydro structure indicates that it is a saturated derivative, which may contribute to its stability and solubility in various solvents. The compound's stereochemistry, indicated by the "trans" designation, suggests specific spatial arrangements of its substituents, which can affect its pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its CAS number, 146117-78-4, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature.
Formula:C14H16ClNO
InChI:InChI=1/C14H16ClNO/c1-16-13-6-2-9-8-10(15)3-4-11(9)12(13)5-7-14(16)17/h3-4,8,12-13H,2,5-7H2,1H3/t12-,13-/m0/s1
Synonyms:- LY-191704
- (4aS,10bS)-8-chloro-4-methyl-1,4,4a,5,6,10b-hexahydrobenzo[f]quinolin-3(2H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LY191704
CAS:<p>LY 191704 is a 5α-reductase type 1 inhibitor.</p>Formula:C14H16ClNOColor and Shape:SolidMolecular weight:249.74
