CAS 146136-94-9

1-Methylethyl (4R)-2-amino-5-cyano-1,4-dihydro-6-methyl-4-(3-phenyl-5-quinolinyl)-3-pyridinecarboxylate

Description:

1-Methylethyl (4R)-2-amino-5-cyano-1,4-dihydro-6-methyl-4-(3-phenyl-5-quinolinyl)-3-pyridinecarboxylate, with CAS number 146136-94-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a cyano group, and a quinoline moiety. This compound is typically classified as a pyridinecarboxylate derivative, featuring both amino and cyano functional groups that contribute to its reactivity and potential biological activity. The presence of the quinoline structure suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its stereochemistry, indicated by the (4R) configuration, may influence its interaction with biological targets, affecting its efficacy and safety profile. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a class of molecules with potential significance in drug discovery and development.

Formula: C₂₆H₂₄N₄O₂

InChI: InChI=1S/C26H24N4O2/c1-15(2)32-26(31)24-23(21(13-27)16(3)30-25(24)28)19-10-7-11-22-20(19)12-18(14-29-22)17-8-5-4-6-9-17/h4-12,14-15,23,30H,28H2,1-3H3/t23-/m1/s1

InChI key: InChIKey=PHJVBZVDUNTGNR-HSZRJFAPSA-N

SMILES: C(OC(C)C)(=O)C=1[C@@H](C(C#N)=C(C)NC1N)C=2C3=C(N=CC(=C3)C4=CC=CC=C4)C=CC2

Synonyms:

• 3-Pyridinecarboxylic acid, 2-amino-5-cyano-1,4-dihydro-6-methyl-4-(3-phenyl-5-quinolinyl)-, 1-methylethyl ester, (R)-
• BAY-y 5959
• 3-Pyridinecarboxylic acid, 2-amino-5-cyano-1,4-dihydro-6-methyl-4-(3-phenyl-5-quinolinyl)-, 1-methylethyl ester, (4R)-
• 1-Methylethyl (4R)-2-amino-5-cyano-1,4-dihydro-6-methyl-4-(3-phenyl-5-quinolinyl)-3-pyridinecarboxylate

BAY-Y-5959

CAS: 146136-94-9

BAY-Y-5959, a calcium channel agonist, is used potentially for the treatment of arrhythmia, heart failure and myocardial.

Formula: C₂₆H₂₄N₄O₂

Color and Shape: Solid

Molecular weight: 424.49

Ref: TM-T26746