CAS 146137-74-8
:2-Fluoro-6-methoxybenzaldehyde
Description:
2-Fluoro-6-methoxybenzaldehyde is an aromatic aldehyde characterized by the presence of a fluorine atom and a methoxy group on a benzene ring. The molecular structure features a benzaldehyde functional group, which is known for its reactivity and ability to undergo various chemical transformations. The fluorine substituent, located at the ortho position relative to the aldehyde group, can influence the electronic properties of the molecule, potentially enhancing its electrophilicity. The methoxy group, positioned at the meta location, contributes to the overall stability and solubility of the compound in organic solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its unique combination of functional groups allows for diverse reactivity, making it a valuable building block in synthetic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H4FIO
InChI:InChI=1/C7H4FIO/c8-7-2-1-6(9)3-5(7)4-10/h1-4H
SMILES:c1cc(c(cc1I)C=O)F
Synonyms:- Rarechem Ak Vd 0022
- 6-Fluoro-O-Anisaldehyde
- 2-Methoxy-6-Fluorobenzaldehyde
- Benzaldehyde, 2-fluoro-6-methoxy-
- 2-Fluoro-6-mehoxybenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzaldehyde, 2-fluoro-6-methoxy-
CAS:Formula:C8H7FO2Purity:98%Color and Shape:SolidMolecular weight:154.13842-Fluoro-6-methoxybenzaldehyde
CAS:2-Fluoro-6-methoxybenzaldehydeFormula:C8H7FO2Purity:98%Color and Shape:White CrystalsMolecular weight:154.14g/mol6-Fluoro-o-anisaldehyde
CAS:Formula:C8H7FO2Purity:>98.0%(GC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:154.142-Fluoro-6-methoxybenzaldehyde
CAS:2-Fluoro-6-methoxybenzaldehyde is a quinone that is used as an intermediate in the synthesis of other organic compounds. It has been shown to be a competitive inhibitor of malonate-induced fibrillation in heart muscle and also slows the reaction time. The pharmacokinetic properties of 2-fluoro-6-methoxybenzaldehyde have been evaluated in dogs, rats, and rabbits. In all three species, 2-fluoro-6-methoxybenzaldehyde showed no significant accumulation in any tissue after intravenous injection and was rapidly excreted unchanged in urine. 2-Fluoro-6-methoxybenzaldehyde may have some potential as an antihypertensive agent due to its ability to reduce blood pressure in rabbits.Formula:C8H7FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:154.14 g/mol2-Fluoro-6-methoxybenzaldehyde
CAS:Formula:C8H7FO2Purity:98%Color and Shape:White fine powderMolecular weight:154.14





