
CAS 146137-93-1
:Methyl 5-cyanobenzo[b]thiophene-2-carboxylate
Description:
Methyl 5-cyanobenzo[b]thiophene-2-carboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring fused to a benzene ring, along with a cyano group and a carboxylate ester functional group. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of the cyano and ester groups. The thiophene moiety contributes to its aromatic character, which can influence its electronic properties and reactivity in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Methyl 5-cyanobenzo[b]thiophene-2-carboxylate may also display interesting photophysical properties, making it a candidate for applications in organic electronics or as a building block in the synthesis of more complex molecules. Its specific applications and behavior in reactions would depend on the context of its use, including the presence of other reagents and the reaction conditions. Overall, this compound is of interest in the fields of organic synthesis and materials science.
Formula:C11H7NO2S
InChI:InChI=1S/C11H7NO2S/c1-14-11(13)10-5-8-4-7(6-12)2-3-9(8)15-10/h2-5H,1H3
InChI key:InChIKey=YFASDULUSJYUSP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=2C(S1)=CC=C(C#N)C2
Synonyms:- Methyl 5-cyanobenzo[b]thiophene-2-carboxylate
- Benzo[b]thiophene-2-carboxylic acid, 5-cyano-, methyl ester
- 5-Cyanobenzo[b]thiophene-2-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
