CAS 1461689-22-4

Cyclohexanamine, 4-(4-methyl-1-piperazinyl)-, hydrochloride (1:3), cis-

Description:

Cyclohexanamine, 4-(4-methyl-1-piperazinyl)-, hydrochloride (1:3), cis- is a chemical compound characterized by its cyclic amine structure, which includes a cyclohexane ring and a piperazine moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the piperazine group contributes to its potential biological activity, as piperazines are known for their roles in medicinal chemistry, often exhibiting psychoactive properties. The "cis" designation indicates the specific stereochemistry of the compound, which can influence its reactivity and interaction with biological targets. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Overall, this compound's unique structure and properties make it of interest in research and development within the fields of medicinal chemistry and pharmacology.

Formula: C₁₁H₂₃N₃·3ClH

InChI: InChI=1/C11H23N3.3ClH/c1-13-6-8-14(9-7-13)11-4-2-10(12)3-5-11;;;/h10-11H,2-9,12H2,1H3;3*1H/t10-,11+;;;

InChI key: InChIKey=GPFXTBDHCSILEG-JBIUWVHTNA-N

SMILES: N[C@H]1CC[C@H](CC1)N2CCN(C)CC2.Cl

Synonyms:

• Cyclohexanamine, 4-(4-methyl-1-piperazinyl)-, hydrochloride (1:3), cis-

4-(4-Methylpiperazin-1-yl)cyclohexan-1-amine trihydrochloride

CAS: 1461689-22-4

Versatile small molecule scaffold

Formula: C₁₁H₂₆Cl₃N₃

Purity: Min. 95%

Molecular weight: 306.7 g/mol

Ref: 3D-LIC68922