CAS 1461704-62-0

5-Oxaspiro[3.4]octan-1-amine, 3-ethoxy-, hydrochloride (1:1)

Description:

5-Oxaspiro[3.4]octan-1-amine, 3-ethoxy-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen-containing amine group and an ethoxy substituent. The presence of the oxaspiro moiety contributes to its potential for diverse reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as basicity due to the amine group, and it could participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Its specific applications and biological activity would depend on its structural characteristics and the context of its use, particularly in medicinal chemistry or as a potential therapeutic agent. Safety and handling considerations would be essential, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₉H₁₇NO₂·ClH

InChI: InChI=1S/C9H17NO2.ClH/c1-2-11-8-6-7(10)9(8)4-3-5-12-9;/h7-8H,2-6,10H2,1H3;1H

InChI key: InChIKey=JNXDENNRAMRJHK-UHFFFAOYSA-N

SMILES: O(CC)C1C2(C(N)C1)CCCO2.Cl

Synonyms:

• 5-Oxaspiro[3.4]octan-1-amine, 3-ethoxy-, hydrochloride (1:1)

3-Ethoxy-5-oxaspiro[3.4]octan-1-amine hydrochloride

CAS: 1461704-62-0

Versatile small molecule scaffold

Formula: C₉H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 207.7 g/mol

Ref: 3D-LIC70462