CAS 1461705-36-1

3H-Imidazo[4,5-b]pyridine-2-methanamine, 3-methyl-, hydrochloride (1:2)

Description:

3H-Imidazo[4,5-b]pyridine-2-methanamine, 3-methyl-, hydrochloride (1:2) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused bicyclic system containing both imidazole and pyridine rings. This compound typically exists as a hydrochloride salt, enhancing its solubility in aqueous solutions. The presence of a methanamine group contributes to its basicity and potential reactivity, while the methyl substitution at the 3-position of the imidazole ring may influence its biological activity and pharmacological properties. Compounds of this class are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The specific characteristics, such as melting point, solubility, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. As with many nitrogen-containing heterocycles, this compound may exhibit interesting interactions with biological macromolecules, making it a subject of interest in drug discovery and development.

Formula: C₈H₁₀N₄·2ClH

InChI: InChI=1S/C8H10N4.2ClH/c1-12-7(5-9)11-6-3-2-4-10-8(6)12;;/h2-4H,5,9H2,1H3;2*1H

InChI key: InChIKey=RCRBCFGJSHJAFH-UHFFFAOYSA-N

SMILES: CN1C=2C(N=C1CN)=CC=CN2.Cl

Synonyms:

• 3H-Imidazo[4,5-b]pyridine-2-methanamine, 3-methyl-, hydrochloride (1:2)

{3-Methyl-3H-imidazo[4,5-b]pyridin-2-yl}methanamine dihydrochloride

CAS: 1461705-36-1

Versatile small molecule scaffold

Formula: C₈H₁₂Cl₂N₄

Purity: Min. 95%

Molecular weight: 235.11 g/mol

Ref: 3D-LIC70536