CAS 1461705-75-8

1H-Pyrazole-1-propanoic acid, α-amino-3,5-dimethyl-, hydrochloride (1:2)

Description:

1H-Pyrazole-1-propanoic acid, α-amino-3,5-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which contributes to its unique reactivity and biological properties. This compound features an α-amino acid moiety, indicating the presence of an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups in amino acids. The presence of two methyl groups at the 3 and 5 positions of the pyrazole ring enhances its lipophilicity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit biological activity, potentially serving as a building block in drug development or as a research tool in biochemical studies. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is handled and stored.

Formula: C₈H₁₃N₃O₂·2ClH

InChI: InChI=1S/C8H13N3O2.2ClH/c1-5-3-6(2)11(10-5)4-7(9)8(12)13;;/h3,7H,4,9H2,1-2H3,(H,12,13);2*1H

InChI key: InChIKey=SQRNUZZYLCGPMV-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)N)N1C(C)=CC(C)=N1.Cl

Synonyms:

• 1H-Pyrazole-1-propanoic acid, α-amino-3,5-dimethyl-, hydrochloride (1:2)

2-Amino-3-(3,5-dimethyl-1H-pyrazol-1-yl)propanoic acid dihydrochloride

CAS: 1461705-75-8

Versatile small molecule scaffold

Formula: C₈H₁₅Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 256.13 g/mol

Ref: 3D-LIC70575