CAS 1461705-76-9

2-Pyridinecarboxylic acid, 3-hydroxy-5-methyl-, hydrobromide (1:1)

Description:

2-Pyridinecarboxylic acid, 3-hydroxy-5-methyl-, hydrobromide (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group and hydroxyl group, contributing to its acidic and potentially polar nature. The presence of a methyl group at the 5-position of the pyridine ring influences its solubility and reactivity. As a hydrobromide salt, it is typically more soluble in water compared to its free acid form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular interactions are influenced by the functional groups present, allowing for potential applications in drug development or as a biochemical reagent. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₇H₇NO₃·BrH

InChI: InChI=1S/C7H7NO3.BrH/c1-4-2-5(9)6(7(10)11)8-3-4;/h2-3,9H,1H3,(H,10,11);1H

InChI key: InChIKey=DPWCDMVFLYQASX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(O)C=C(C)C=N1.Br

Synonyms:

• 2-Pyridinecarboxylic acid, 3-hydroxy-5-methyl-, hydrobromide (1:1)

3-Hydroxy-5-methylpyridine-2-carboxylic acid hydrobromide

CAS: 1461705-76-9

Versatile small molecule scaffold

Formula: C₇H₈BrNO₃

Purity: Min. 95%

Molecular weight: 234.05 g/mol

Ref: 3D-LIC70576