CAS 1461706-21-7

Acetamide, N-(2-amino-3-pyridinyl)-, hydrochloride (1:1)

Description:

Acetamide, N-(2-amino-3-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a pyridine ring, which contributes to its biological activity. The presence of the amino group on the pyridine ring enhances its potential for hydrogen bonding and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, particularly in pharmaceutical formulations. This compound may exhibit properties such as moderate to high melting points and stability under standard laboratory conditions. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's characteristics, including solubility, stability, and reactivity, can be influenced by factors such as pH and temperature. Overall, Acetamide, N-(2-amino-3-pyridinyl)-, hydrochloride (1:1) is a versatile compound with potential applications in drug development and research.

Formula: C₇H₉N₃O·ClH

InChI: InChI=1S/C7H9N3O.ClH/c1-5(11)10-6-3-2-4-9-7(6)8;/h2-4H,1H3,(H2,8,9)(H,10,11);1H

InChI key: InChIKey=DRCXAFWXTKFEGY-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(N)N=CC=C1.Cl

Synonyms:

• Acetamide, N-(2-amino-3-pyridinyl)-, hydrochloride (1:1)

N-(2-Aminopyridin-3-yl)acetamide hydrochloride

CAS: 1461706-21-7

Versatile small molecule scaffold

Formula: C₇H₁₀ClN₃O

Purity: Min. 95%

Molecular weight: 187.63 g/mol

Ref: 3D-LIC70621