CAS 1461706-38-6

Pyrrolidine, 2-(3-bromo-2-methylphenyl)-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-(3-bromo-2-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of the 3-bromo-2-methylphenyl group indicates that the compound has a bromine substituent and a methyl group on the aromatic ring, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially influencing its use in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the presence of the bromine atom, which can participate in electrophilic substitution reactions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound represents a specific class of organic molecules with potential applications in drug development and research.

Formula: C₁₁H₁₄BrN·ClH

InChI: InChI=1S/C11H14BrN.ClH/c1-8-9(4-2-5-10(8)12)11-6-3-7-13-11;/h2,4-5,11,13H,3,6-7H2,1H3;1H

InChI key: InChIKey=YILQENRUHBUSRB-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1Br)C2CCCN2.Cl

Synonyms:

• Pyrrolidine, 2-(3-bromo-2-methylphenyl)-, hydrochloride (1:1)

2-(3-Bromo-2-methylphenyl)pyrrolidine hydrochloride

CAS: 1461706-38-6

Versatile small molecule scaffold

Formula: C₁₁H₁₅BrClN

Purity: Min. 95%

Molecular weight: 276.6 g/mol

Ref: 3D-LIC70638