CAS 1461706-39-7

2H-1,3-Thiazine-4-carboxylic acid, 2-ethyltetrahydro-, hydrochloride (1:1)

Description:

2H-1,3-Thiazine-4-carboxylic acid, 2-ethyltetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its thiazine ring structure, which incorporates both sulfur and nitrogen atoms. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique functional groups. The presence of the carboxylic acid moiety suggests it can participate in acid-base reactions, while the hydrochloride form indicates it is a salt that enhances solubility in polar solvents, particularly water. The ethyl group contributes to the compound's hydrophobic characteristics, influencing its interaction with biological membranes. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other chemical species. As with many thiazine derivatives, it may also exhibit antimicrobial or anti-inflammatory properties, warranting further investigation in medicinal chemistry.

Formula: C₇H₁₃NO₂S·ClH

InChI: InChI=1S/C7H13NO2S.ClH/c1-2-6-8-5(7(9)10)3-4-11-6;/h5-6,8H,2-4H2,1H3,(H,9,10);1H

InChI key: InChIKey=COKJLUXEFLZYNO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1NC(CC)SCC1.Cl

Synonyms:

• 2H-1,3-Thiazine-4-carboxylic acid, 2-ethyltetrahydro-, hydrochloride (1:1)

2-Ethyl-1,3-thiazinane-4-carboxylic acid hydrochloride

CAS: 1461706-39-7

Versatile small molecule scaffold

Formula: C₇H₁₄ClNO₂S

Purity: Min. 95%

Molecular weight: 211.71 g/mol

Ref: 3D-LIC70639