CAS 1461706-67-1

S-(4-Amino-1-naphthalenyl) N,N-dimethylcarbamothioate

Description:

S-(4-Amino-1-naphthalenyl) N,N-dimethylcarbamothioate is a chemical compound characterized by its unique structure, which includes a naphthalene ring substituted with an amino group and a carbamothioate functional group. This compound typically exhibits properties associated with both aromatic and thioester functionalities, which may influence its reactivity and interactions in various chemical environments. It is likely to be a solid at room temperature, with potential solubility in organic solvents due to its aromatic nature. The presence of the amino group suggests potential for hydrogen bonding and reactivity in biological systems, making it of interest in medicinal chemistry. Additionally, the dimethylcarbamothioate moiety may impart specific biological activities, possibly related to its role as a thiol or as a precursor in synthetic pathways. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound may have applications in research, particularly in the fields of organic synthesis and pharmacology.

Formula: C₁₃H₁₄N₂OS

InChI: InChI=1S/C13H14N2OS/c1-15(2)13(16)17-12-8-7-11(14)9-5-3-4-6-10(9)12/h3-8H,14H2,1-2H3

InChI key: InChIKey=KZTARCOWBBEYEH-UHFFFAOYSA-N

SMILES: S(C(N(C)C)=O)C=1C2=C(C(N)=CC1)C=CC=C2

Synonyms:

• Carbamothioic acid, N,N-dimethyl-, S-(4-amino-1-naphthalenyl) ester
• 1-[(4-Aminonaphthalen-1-yl)sulfanyl]-N,N-dimethylformamide
• S-(4-Amino-1-naphthalenyl) N,N-dimethylcarbamothioate

1-[(4-Aminonaphthalen-1-yl)sulfanyl]-N,N-dimethylformamide

CAS: 1461706-67-1

Versatile small molecule scaffold

Formula: C₁₃H₁₄N₂OS

Purity: Min. 95%

Molecular weight: 246.33 g/mol

Ref: 3D-LIC70667