CAS 1461707-01-6

3-(4-Morpholinyl)-4-pyridinecarbonitrile

Description:

3-(4-Morpholinyl)-4-pyridinecarbonitrile is a chemical compound characterized by its pyridine and morpholine functional groups. It features a pyridine ring substituted with a cyano group and a morpholine moiety, which contributes to its potential biological activity. The presence of the cyano group enhances its reactivity, making it a useful intermediate in organic synthesis. Morpholine, a six-membered ring containing both oxygen and nitrogen, imparts unique properties such as increased solubility in polar solvents and potential interactions with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential hydrogen bonding and dipole interactions, which can influence its behavior in biological systems. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 3-(4-Morpholinyl)-4-pyridinecarbonitrile is a versatile compound with applications in research and development, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₁N₃O

InChI: InChI=1S/C10H11N3O/c11-7-9-1-2-12-8-10(9)13-3-5-14-6-4-13/h1-2,8H,3-6H2

InChI key: InChIKey=LGOZKHWDEGNZIR-UHFFFAOYSA-N

SMILES: C(#N)C=1C(=CN=CC1)N2CCOCC2

Synonyms:

• 4-Pyridinecarbonitrile, 3-(4-morpholinyl)-
• 3-(4-Morpholinyl)-4-pyridinecarbonitrile

3-(Morpholin-4-yl)pyridine-4-carbonitrile

CAS: 1461707-01-6

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃O

Purity: Min. 95%

Molecular weight: 189.21 g/mol

Ref: 3D-LIC70701