CAS 1461707-88-9

3-Fluoro-α-[(1-methylethoxy)methyl]benzenemethanol

Description:

3-Fluoro-α-[(1-methylethoxy)methyl]benzenemethanol is a chemical compound characterized by its unique molecular structure, which includes a fluorine atom and a methoxy group attached to a benzene ring. The presence of the fluorine atom typically imparts increased lipophilicity and can influence the compound's reactivity and biological activity. The methoxy group, derived from isopropanol, contributes to the compound's solubility and stability. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the steric and electronic effects of the substituents on the benzene ring. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy methods like NMR and mass spectrometry for confirmation of its structure. Overall, 3-Fluoro-α-[(1-methylethoxy)methyl]benzenemethanol represents a class of compounds that may have potential applications in pharmaceuticals or agrochemicals, depending on its specific properties and biological activities.

Formula: C₁₁H₁₅FO₂

InChI: InChI=1S/C11H15FO2/c1-8(2)14-7-11(13)9-4-3-5-10(12)6-9/h3-6,8,11,13H,7H2,1-2H3

InChI key: InChIKey=FDTWLPHMGCNIJH-UHFFFAOYSA-N

SMILES: C(COC(C)C)(O)C1=CC(F)=CC=C1

Synonyms:

• Benzenemethanol, 3-fluoro-α-[(1-methylethoxy)methyl]-
• 3-Fluoro-α-[(1-methylethoxy)methyl]benzenemethanol

1-(3-Fluorophenyl)-2-(propan-2-yloxy)ethan-1-ol

CAS: 1461707-88-9

Versatile small molecule scaffold

Formula: C₁₁H₁₅FO₂

Purity: Min. 95%

Molecular weight: 198.23 g/mol

Ref: 3D-LIC70788