CAS 1461708-03-1

Benzamide, 2-hydroxy-5-[2-[[(2-methoxyphenyl)methyl]amino]-4-thiazolyl]-, hydrochloride (1:1)

Description:

Benzamide, 2-hydroxy-5-[2-[[(2-methoxyphenyl)methyl]amino]-4-thiazolyl]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzamide core, a hydroxyl group, and a thiazole moiety. This compound features a methoxyphenyl group attached to a methylamino group, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a hydrochloride, which often enhances solubility in water and stability. The presence of the thiazole ring suggests potential applications in medicinal chemistry, as thiazoles are known for their diverse pharmacological properties. The compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would require empirical investigation. Its molecular interactions, solubility, and stability are influenced by the functional groups present, making it a candidate for further research in drug development and synthesis. As with any chemical substance, safety data and handling precautions should be observed when working with this compound.

Formula: C₁₈H₁₇N₃O₃S·ClH

InChI: InChI=1S/C18H17N3O3S.ClH/c1-24-16-5-3-2-4-12(16)9-20-18-21-14(10-25-18)11-6-7-15(22)13(8-11)17(19)23;/h2-8,10,22H,9H2,1H3,(H2,19,23)(H,20,21);1H

InChI key: InChIKey=RTRJPCHEWIOTRU-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1C=C(C=CC1O)C=2N=C(NCC3=C(OC)C=CC=C3)SC2.Cl

Synonyms:

• Benzamide, 2-hydroxy-5-[2-[[(2-methoxyphenyl)methyl]amino]-4-thiazolyl]-, hydrochloride (1:1)

2-Hydroxy-5-(2-{[(2-methoxyphenyl)methyl]amino}-1,3-thiazol-4-yl)benzamide hydrochloride

CAS: 1461708-03-1

Versatile small molecule scaffold

Formula: C₁₈H₁₈ClN₃O₃S

Purity: Min. 95%

Molecular weight: 391.9 g/mol

Ref: 3D-LIC70803