CAS 1461708-28-0

5-Thiazolamine, 4-cyclopentyl-, hydrochloride (1:2)

Description:

5-Thiazolamine, 4-cyclopentyl-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing sulfur and nitrogen. The presence of the cyclopentyl group indicates that there is a cyclopentane moiety attached to the thiazolamine, which can influence the compound's physical and chemical properties, such as solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential for biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including its interaction with biological targets and its mechanism of action. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₈H₁₂N₂S·2ClH

InChI: InChI=1S/C8H12N2S.2ClH/c9-8-7(10-5-11-8)6-3-1-2-4-6;;/h5-6H,1-4,9H2;2*1H

InChI key: InChIKey=RYYUZSKYWRUFMA-UHFFFAOYSA-N

SMILES: NC1=C(N=CS1)C2CCCC2.Cl

Synonyms:

• 5-Thiazolamine, 4-cyclopentyl-, hydrochloride (1:2)

4-Cyclopentyl-1,3-thiazol-5-amine dihydrochloride

CAS: 1461708-28-0

Versatile small molecule scaffold

Formula: C₈H₁₄Cl₂N₂S

Purity: Min. 95%

Molecular weight: 241.18 g/mol

Ref: 3D-LIC70828