CAS 1461713-60-9

1H-Pyrrolo[2,3-b]pyridine, 3-bromo-, hydrobromide (1:1)

Description:

1H-Pyrrolo[2,3-b]pyridine, 3-bromo-, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features a bromine atom at the 3-position of the pyrrolo moiety, contributing to its reactivity and potential applications in medicinal chemistry. The hydrobromide form indicates that the compound exists as a salt, which can enhance its solubility in polar solvents, making it suitable for various chemical reactions and biological assays. Typically, compounds of this nature are of interest in the development of pharmaceuticals, particularly in the search for new therapeutic agents due to their ability to interact with biological targets. The presence of the bromine substituent may also influence the compound's electronic properties and steric factors, which are critical in drug design. Overall, 1H-Pyrrolo[2,3-b]pyridine, 3-bromo-, hydrobromide (1:1) represents a valuable entity in the field of organic chemistry and drug discovery.

Formula: C₇H₅BrN₂·BrH

InChI: InChI=1S/C7H5BrN2.BrH/c8-6-4-10-7-5(6)2-1-3-9-7;/h1-4H,(H,9,10);1H

InChI key: InChIKey=ZZRQBIUZOGNGLU-UHFFFAOYSA-N

SMILES: BrC=1C=2C(=NC=CC2)NC1.Br

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 3-bromo-, hydrobromide (1:1)

3-Bromo-1H-pyrrolo[2,3-b]pyridine hydrobromide

CAS: 1461713-60-9

3-Bromo-1H-pyrrolo[2,3-b]pyridine hydrobromide

Purity: 95%

Molecular weight: 277.95g/mol

Ref: 54-OR1053491

3-Bromo-1h-pyrrolo[2,3-b]pyridine hydrobromide

CAS: 1461713-60-9

Purity: 95%

Molecular weight: 277.946991

Ref: 10-F651837