CAS 1461713-92-7

2-Piperidinecarboxamide, 2-methyl-, hydrochloride (1:1)

Description:

2-Piperidinecarboxamide, 2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a pharmacologically active agent. The presence of the methyl group at the second position of the piperidine ring influences its steric and electronic properties, which can affect its biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand for biological targets, and its hydrochloride form can facilitate easier handling and stability. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Its specific applications and effects would depend on further research and characterization, including studies on its pharmacodynamics and pharmacokinetics.

Formula: C₇H₁₄N₂O·ClH

InChI: InChI=1S/C7H14N2O.ClH/c1-7(6(8)10)4-2-3-5-9-7;/h9H,2-5H2,1H3,(H2,8,10);1H

InChI key: InChIKey=RUAUYYAJDFIEEK-UHFFFAOYSA-N

SMILES: C(N)(=O)C1(C)CCCCN1.Cl

Synonyms:

• 2-Piperidinecarboxamide, 2-methyl-, hydrochloride (1:1)

2-Methylpiperidine-2-carboxamide hydrochloride

CAS: 1461713-92-7

Versatile small molecule scaffold

Formula: C₇H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 178.66 g/mol

Ref: 3D-LIC71392