CAS 1461713-98-3

Morpholine, 3-[5-(1-methylethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

Description:

Morpholine, 3-[5-(1-methylethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its morpholine core, which is a six-membered heterocyclic amine containing one oxygen atom and one nitrogen atom. The presence of the 1,2,4-oxadiazole moiety introduces additional heteroatoms, contributing to its potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacokinetic properties. Morpholine derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific substitution pattern of the oxadiazole ring, particularly the isopropyl group, may impart unique properties, such as increased lipophilicity or altered reactivity. As with many morpholine derivatives, it may exhibit a range of biological activities, including antimicrobial or anti-inflammatory effects, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₅N₃O₂.ClH

InChI: InChI=1S/C9H15N3O2.ClH/c1-6(2)9-11-8(12-14-9)7-5-13-4-3-10-7;/h6-7,10H,3-5H2,1-2H3;1H

InChI key: InChIKey=OUKNMFPUPXSYEC-UHFFFAOYSA-N

SMILES: C(C)(C)C1=NC(=NO1)C2COCCN2.Cl

3-[5-(Propan-2-yl)-1,2,4-oxadiazol-3-yl]morpholine hydrochloride

CAS: 1461713-98-3

Versatile small molecule scaffold

Formula: C₉H₁₆ClN₃O₂

Purity: Min. 95%

Molecular weight: 233.69 g/mol

Ref: 3D-LIC71398