CAS 1461714-24-8

Imidazo[1,5-a]pyridine-7-carboxylic acid, 3-cyclohexyl-5,6,7,8-tetrahydro-, hydrochloride (1:1)

Description:

Imidazo[1,5-a]pyridine-7-carboxylic acid, 3-cyclohexyl-5,6,7,8-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine core structure, which is known for its biological activity and potential pharmacological applications. The presence of the carboxylic acid functional group contributes to its acidity and solubility in polar solvents. The cyclohexyl substituent enhances its lipophilicity, potentially influencing its interaction with biological membranes. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, facilitating its use in various formulations. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or neuroprotective effects, making it of interest in medicinal chemistry. Its specific characteristics, including melting point, solubility, and spectral data, would depend on the purity and specific conditions under which it is studied. Overall, this compound represents a class of heterocyclic compounds that are valuable in drug discovery and development.

Formula: C₁₄H₂₀N₂O₂·ClH

InChI: InChI=1S/C14H20N2O2.ClH/c17-14(18)11-6-7-16-12(8-11)9-15-13(16)10-4-2-1-3-5-10;/h9-11H,1-8H2,(H,17,18);1H

InChI key: InChIKey=GUKTZEOYGKTRIE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC=2N(C(=NC2)C3CCCCC3)CC1.Cl

Synonyms:

• Imidazo[1,5-a]pyridine-7-carboxylic acid, 3-cyclohexyl-5,6,7,8-tetrahydro-, hydrochloride (1:1)

3-Cyclohexyl-5H,6H,7H,8H-imidazo[1,5-a]pyridine-7-carboxylic acid hydrochloride

CAS: 1461714-24-8

Versatile small molecule scaffold

Formula: C₁₄H₂₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 284.78 g/mol

Ref: 3D-LIC71424