CAS 1461714-29-3

4-Isoxazolamine, 3-methyl-5-phenyl-, hydrochloride (1:1)

Description:

4-Isoxazolamine, 3-methyl-5-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance typically exhibits properties associated with amines and heterocycles, such as potential biological activity and solubility in polar solvents due to the presence of the hydrochloride salt form. The methyl and phenyl substituents on the isoxazole ring contribute to its unique chemical behavior and may influence its pharmacological properties. As a hydrochloride salt, it is likely to be more stable and soluble in aqueous solutions, making it suitable for various applications in medicinal chemistry. The compound may be of interest in research related to pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. However, detailed studies on its toxicity, efficacy, and specific applications would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₀H₁₀N₂O·ClH

InChI: InChI=1S/C10H10N2O.ClH/c1-7-9(11)10(13-12-7)8-5-3-2-4-6-8;/h2-6H,11H2,1H3;1H

InChI key: InChIKey=FESVIOZFFJTQJS-UHFFFAOYSA-N

SMILES: NC1=C(ON=C1C)C2=CC=CC=C2.Cl

Synonyms:

• 4-Isoxazolamine, 3-methyl-5-phenyl-, hydrochloride (1:1)

3-Methyl-5-phenyl-1,2-oxazol-4-amine hydrochloride

CAS: 1461714-29-3

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂O

Purity: Min. 95%

Molecular weight: 210.66 g/mol

Ref: 3D-LIC71429