CAS 1461715-05-8

2H-Tetrazole-5-methanamine, α-(3,4-difluorophenyl)-, hydrochloride (1:1)

Description:

2H-Tetrazole-5-methanamine, α-(3,4-difluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its tetrazole ring structure, which is a five-membered aromatic ring containing four nitrogen atoms and one carbon atom. This compound features a methanamine group and a difluorophenyl substituent, contributing to its unique chemical properties. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, which typically enhances its solubility in water and may influence its biological activity. The difluorophenyl group suggests potential applications in medicinal chemistry, as fluorinated compounds often exhibit improved pharmacokinetic properties. The compound's structure may also confer specific reactivity patterns, making it of interest in various synthetic and pharmaceutical applications. Overall, its characteristics, including solubility, stability, and reactivity, are influenced by the functional groups present and the overall molecular architecture.

Formula: C₈H₇F₂N₅·ClH

InChI: InChI=1S/C8H7F2N5.ClH/c9-5-2-1-4(3-6(5)10)7(11)8-12-14-15-13-8;/h1-3,7H,11H2,(H,12,13,14,15);1H

InChI key: InChIKey=QYAYGWBJLJADAQ-UHFFFAOYSA-N

SMILES: C(N)(C1=CC(F)=C(F)C=C1)C=2NN=NN2.Cl

Synonyms:

• 2H-Tetrazole-5-methanamine, α-(3,4-difluorophenyl)-, hydrochloride (1:1)

(3,4-Difluorophenyl)(1H-1,2,3,4-tetrazol-5-yl)methanamine hydrochloride

CAS: 1461715-05-8

Versatile small molecule scaffold

Formula: C₈H₈ClF₂N₅

Purity: Min. 95%

Molecular weight: 247.63 g/mol

Ref: 3D-LIC71505