CAS 1461715-34-3

Carbamic acid, N-[1-(3′-cyano[1,1′-biphenyl]-4-yl)ethyl]-, 1,1-dimethylethyl ester

Description:

Carbamic acid, N-[1-(3′-cyano[1,1′-biphenyl]-4-yl)ethyl]-, 1,1-dimethylethyl ester, identified by CAS number 1461715-34-3, is a chemical compound characterized by its unique structure that includes a carbamic acid moiety and a cyano-substituted biphenyl group. This compound typically exhibits properties associated with both carbamates and cyano compounds, such as potential biological activity and stability under various conditions. The presence of the cyano group may impart specific reactivity and polarity, influencing its solubility in organic solvents. Additionally, the ester functionality suggests that it may undergo hydrolysis under acidic or basic conditions, releasing the corresponding carbamic acid. Its molecular structure indicates potential applications in pharmaceuticals or agrochemicals, where such compounds are often explored for their biological activities. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses.

Formula: C₂₀H₂₂N₂O₂

InChI: InChI=1S/C20H22N2O2/c1-14(22-19(23)24-20(2,3)4)16-8-10-17(11-9-16)18-7-5-6-15(12-18)13-21/h5-12,14H,1-4H3,(H,22,23)

InChI key: InChIKey=KXQOEZKIJIBGGW-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C2=CC=C(C(NC(OC(C)(C)C)=O)C)C=C2)C=CC1

Synonyms:

• tert-Butyl N-{1-[4-(3-cyanophenyl)phenyl]ethyl}carbamate
• Carbamic acid, N-[1-(3′-cyano[1,1′-biphenyl]-4-yl)ethyl]-, 1,1-dimethylethyl ester

tert-Butyl N-{1-[4-(3-cyanophenyl)phenyl]ethyl}carbamate

CAS: 1461715-34-3

Versatile small molecule scaffold

Formula: C₂₀H₂₂N₂O₂

Purity: Min. 95%

Molecular weight: 322.4 g/mol

Ref: 3D-LIC71534