
CAS 1461726-92-0
:2-(4-Fluorophenyl)-6,7-dihydro-4(5H)-benzothiazolone oxime
Description:
2-(4-Fluorophenyl)-6,7-dihydro-4(5H)-benzothiazolone oxime, identified by its CAS number 1461726-92-0, is a chemical compound that features a benzothiazolone core structure, which is characterized by a fused benzene and thiazole ring. The presence of a fluorophenyl group indicates that there is a fluorine atom substituted on the phenyl ring, which can influence the compound's electronic properties and reactivity. The oxime functional group, derived from the reaction of an aldehyde or ketone with hydroxylamine, suggests potential for further chemical transformations, including condensation reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its physical properties, such as solubility, melting point, and stability, would depend on the specific molecular interactions and the presence of functional groups. Overall, this compound represents a unique structure that could be explored for various applications in medicinal chemistry and material science.
Formula:C13H11FN2OS
InChI:InChI=1S/C13H11FN2OS/c14-9-6-4-8(5-7-9)13-15-12-10(16-17)2-1-3-11(12)18-13/h4-7,17H,1-3H2
InChI key:InChIKey=OUPRRQJFXORULA-UHFFFAOYSA-N
SMILES:N(O)=C1C2=C(SC(=N2)C3=CC=C(F)C=C3)CCC1
Synonyms:- 4(5H)-Benzothiazolone, 2-(4-fluorophenyl)-6,7-dihydro-, oxime
- 2-(4-Fluorophenyl)-6,7-dihydro-4(5H)-benzothiazolone oxime
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery