CAS 146183-25-7
:Oligo(dT)
Description:
Oligo(dT) refers to a synthetic oligonucleotide composed of deoxythymidine monomers, typically used in molecular biology applications, particularly in the isolation of mRNA. The CAS number 146183-25-7 specifically identifies a form of this oligonucleotide. Oligo(dT) sequences are characterized by their ability to hybridize with the polyadenylated tails of eukaryotic mRNA, facilitating the capture of mRNA from total RNA samples. This property makes oligo(dT) a crucial tool in techniques such as reverse transcription polymerase chain reaction (RT-PCR) and cDNA synthesis. The oligonucleotide is generally stable under physiological conditions, but its stability can be influenced by factors such as temperature, ionic strength, and the presence of nucleases. Oligo(dT) can vary in length, with longer sequences providing higher specificity for mRNA capture. Additionally, it is often used in conjunction with other primers or probes in various genetic and genomic analyses, making it a versatile component in the toolkit of molecular biologists.
Formula:(C10H14N2O5)x
InChI:InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1
InChI key:InChIKey=IQFYYKKMVGJFEH-XLPZGREQSA-N
SMILES:O=C1N([C@@H]2O[C@H](CO)[C@@H](O)C2)C=C(C)C(=O)N1
Synonyms:- Thymidine, homopolymer
- Oligo(dT)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
