CAS 146269-94-5
:AF2 neuropeptide
Description:
AF2 neuropeptide, identified by its CAS number 146269-94-5, is a synthetic peptide that plays a role in neurobiology, particularly in the modulation of neuronal activity and signaling pathways. This neuropeptide is characterized by its specific amino acid sequence, which influences its biological activity and interaction with receptors in the nervous system. AF2 neuropeptide is known to exhibit properties such as neuroprotective effects, modulation of pain perception, and potential roles in stress response and mood regulation. Its structure typically includes a sequence of amino acids that can form specific secondary structures, contributing to its stability and function. The peptide's activity is often studied in the context of neurodegenerative diseases and psychiatric disorders, making it a subject of interest in pharmacological research. Additionally, AF2 neuropeptide may interact with various neurotransmitter systems, highlighting its potential therapeutic applications in neurology and psychiatry.
Formula:C47H70N14O10
InChI:InChI=1/C47H70N14O10/c1-27(2)21-36(44(69)56-33(12-8-20-54-47(51)52)42(67)58-35(40(50)65)22-28-9-4-3-5-10-28)60-45(70)37(23-29-13-15-31(62)16-14-29)61-43(68)34(17-18-39(63)64)57-46(71)38(24-30-25-53-26-55-30)59-41(66)32(49)11-6-7-19-48/h3-5,9-10,13-16,25-27,30,32-38,62H,6-8,11-12,17-24,48-49H2,1-2H3,(H2,50,65)(H,56,69)(H,57,71)(H,58,67)(H,59,66)(H,60,70)(H,61,68)(H,63,64)(H4,51,52,54)/t30?,32-,33-,34-,35-,36-,37-,38-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1ccccc1)C(=N)O)O)O)N=C([C@H](Cc1ccc(cc1)O)N=C([C@H](CCC(=O)O)N=C([C@H](CC1C=NC=N1)N=C([C@H](CCCCN)N)O)O)O)O
Synonyms:- Fmrfamidelike peptide AF2
- Lys-his-glu-tyr-leu-arg-phe-NH2
- L-Phenylalaninamide, L-lysyl-L-histidyl-L-alpha-glutamyl-L-tyrosyl-L-leucyl-L-arginyl-
- L-lysyl-3-(4H-imidazol-4-yl)-L-alanyl-L-alpha-glutamyl-L-tyrosyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
- AF2 Neuropeptide
- AF-2 H-Lys-His-Glu-Tyr-Leu-Arg-Phe-NH2
- L-Phenylalaninamide, L-lysyl-L-histidyl-L-α-glutamyl-L-tyrosyl-L-leucyl-L-arginyl-
- (4S)-5-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Phenylalaninamide, L-lysyl-L-histidyl-L-α-glutamyl-L-tyrosyl-L-leucyl-L-arginyl-
CAS:Formula:C47H70N14O10Molecular weight:991.1465AF2 Neuropeptide
CAS:AF2 is the nematode neuropeptide. It also increases voltage-activated calcium currents in Ascaris suum muscle.Formula:C47H70N14O10Purity:98%Color and Shape:SolidMolecular weight:991.15(4S)-5-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino ]-4-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-4-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino
CAS:Custom research peptide; min purity 95%. For different specs please use the Peptide Quote ToolFormula:C47H70N14O10Molecular weight:991.17 g/molAF-2
CAS:<p>AF-2 is a potent, selective and competitive antagonist at the nicotinic acetylcholine receptor (nAChR). AF-2 binds to the extracellular domains of the nAChR and prevents agonists from binding. It has been shown to inhibit acetylcholine release in isolated heart preparations with high affinity and selectivity. The drug has been tested as an anthelmintic against Caenorhabditis elegans and found to be effective. AF-2 is a cholinergic compound that binds to ganglia, leading to a biphasic response. It also has significant effects on the central nervous system, inhibiting both nicotinic and muscarinic acetylcholine receptors.<br>AF-2 is sequenced according to the following formula: <br>H-Lys-His-Glu-Tyr-Leu-Arg-Phe <br>NH2</p>Formula:C47H70N14O10Purity:Min. 95%Molecular weight:991.15 g/mol


