CAS 146275-18-5: trans-3'-Hydroxycotinine-N-b-D-glucuronide
Description:Trans-3'-Hydroxycotinine-N-b-D-glucuronide is a metabolite of nicotine, specifically a glucuronide conjugate of 3'-hydroxycotinine, which is a primary metabolite of nicotine in the human body. This compound is characterized by its glucuronidation, a biochemical process that involves the addition of glucuronic acid to a substrate, enhancing its solubility and facilitating excretion. The structure of trans-3'-Hydroxycotinine-N-b-D-glucuronide includes a hydroxyl group and a glucuronide moiety, which contribute to its polar nature. This polar characteristic is significant for its pharmacokinetics, as it influences the compound's absorption, distribution, metabolism, and excretion. The compound is primarily studied in the context of nicotine metabolism and its implications for tobacco use and dependence. Its presence in biological samples can serve as a biomarker for nicotine exposure. Overall, trans-3'-Hydroxycotinine-N-b-D-glucuronide plays a crucial role in understanding the metabolic pathways of nicotine and its effects on human health.
Formula:C16H20N2O8
InChI:InChI=1/C16H20N2O8/c1-18-8(7-3-2-4-17-6-7)5-9(14(18)22)25-16-12(21)10(19)11(20)13(26-16)15(23)24/h2-4,6,8-13,16,19-21H,5H2,1H3,(H,23,24)
- Synonyms:
- trans-3-Hydroxycotinine glucuronide
- 1-Methyl-2-Oxo-5-(Pyridin-3-Yl)Pyrrolidin-3-Yl Hexopyranosiduronic Acid

trans-3'-Hydroxy Cotinine N-β-D-Glucuronide
Controlled ProductRef: TR-H924530
1mg | 1,249.00 € | ||
2mg | 1,959.00 € | ||
5mg | 5,045.00 € |

trans-3'-Hydroxy Cotinine-d3 N-Beta-D-Glucuronide
Controlled ProductRef: TR-H924535
1mg | 1,919.00 € |

N-(trans-3-Hydroxycotinine)-b-D-glucuronide
Ref: 3D-MH07435
1mg | 1,031.00 € | ||
2mg | 1,884.00 € | ||
5mg | 4,536.00 € |