CymitQuimica logo

CAS 146306-75-4

:

Fmoc-allo-Thr-OH

Description:
Fmoc-allo-Thr-OH, or 2-amino-3-(9-fluorenylmethoxycarbonyl)-2-methylpropanoic acid, is a derivative of threonine, an amino acid commonly used in peptide synthesis. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly. The "allo" designation indicates a specific stereochemistry, distinguishing it from the standard threonine structure. This compound is typically utilized in solid-phase peptide synthesis due to its stability and ease of removal under mild basic conditions. Fmoc-allo-Thr-OH is characterized by its ability to participate in peptide bond formation, contributing to the synthesis of peptides with unique structural and functional properties. Its solubility in organic solvents and moderate solubility in water make it versatile for various synthetic applications. Additionally, the presence of the Fmoc group allows for UV detection, facilitating monitoring during synthesis. Overall, Fmoc-allo-Thr-OH is a valuable building block in the field of peptide chemistry and drug development.
Formula:CHNO5
InChI:InChI=1S/C19H19NO5/c1-11(21)17(18(22)23)20-19(24)25-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,11,16-17,21H,10H2,1H3,(H,20,24)(H,22,23)/t11-,17-/m0/s1
InChI key:OYULCCKKLJPNPU-GTNSWQLSSA-N
SMILES:C[C@@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O
Found 4 products.