CAS 14631-08-4
:2-Chloro-4,5-pyrimidinediamine
Description:
2-Chloro-4,5-pyrimidinediamine, with the CAS number 14631-08-4, is an organic compound characterized by its pyrimidine ring structure, which contains two amino groups and a chlorine substituent. This compound typically appears as a crystalline solid and is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding due to the presence of amino groups. The chlorine atom introduces a halogen functionality, which can influence the compound's reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. 2-Chloro-4,5-pyrimidinediamine is of interest in medicinal chemistry and agricultural chemistry, often serving as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its biological activity may be attributed to the presence of the pyrimidine core, which is a common motif in many biologically active compounds. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C4H5ClN4
InChI:InChI=1S/C4H5ClN4/c5-4-8-1-2(6)3(7)9-4/h1H,6H2,(H2,7,8,9)
InChI key:InChIKey=QDUJVEOOSNUDDW-UHFFFAOYSA-N
SMILES:NC=1C(N)=CN=C(Cl)N1
Synonyms:- 2-Chloro-4,5-Diaminopyrimidine
- 2-Chloro-4,5-diamino pyrimidine
- 2-Chloro-4,5-pyrimidinediamine
- 4,5-Diamino-2-chloropyrimidine
- 4,5-Pyrimidinediamine, 2-chloro-
- Ai3-52054
- NSC 45754
- Pyrimidine, 4,5-diamino-2-chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,5-Pyrimidinediamine, 2-chloro-
CAS:Formula:C4H5ClN4Purity:97%Color and Shape:SolidMolecular weight:144.56232-Chloropyrimidine-4,5-diamine
CAS:2-Chloropyrimidine-4,5-diaminePurity:≥95%Color and Shape:SolidMolecular weight:144.56g/mol2-Chloro-4,5-diaminopyrimidine
CAS:2-Chloro-4,5-diaminopyrimidine is a pyrimidine compound with the molecular formula CHClN. It can be synthesized by reacting glycine and phenol with piperidine in the presence of hydrochloric acid. 2-Chloro-4,5-diaminopyrimidine has a solubility of 1.2 g/100 mL in water and reacts with quinine to form a red solution. This product also reacts with proline to produce an orange solution that fluoresces green when exposed to UV light. 2-Chloro-4,5-diaminopyrimidine has been used as an intermediate in the synthesis of other compounds such as pyridoxal phosphate and cefixime.Formula:C4H5ClN4Purity:Min. 95%Color and Shape:PowderMolecular weight:144.56 g/mol2-Chloropyrimidine-4,5-diamine
CAS:Formula:C4H5ClN4Purity:97%Color and Shape:SolidMolecular weight:144.56




