CymitQuimica logo

CAS 146321-89-3

:

Ethanone, 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-, oxime

Description:
Ethanone, 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-, oxime, with the CAS number 146321-89-3, is a chemical compound characterized by its oxime functional group, which is derived from the reaction of ethanone with hydroxylamine. This compound features a complex bicyclic structure that includes a benzodioxepin moiety, contributing to its unique chemical properties. Typically, compounds of this nature may exhibit various biological activities, making them of interest in medicinal chemistry and pharmacology. The presence of the oxime group can influence the compound's reactivity, stability, and potential interactions with biological targets. Additionally, the stereochemistry of the compound may play a significant role in its biological efficacy. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific molecular interactions and the environment in which it is studied. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c1-8(12-13)9-3-4-10-11(7-9)15-6-2-5-14-10/h3-4,7,13H,2,5-6H2,1H3
InChI key:InChIKey=KAJUEPSASIYCGN-UHFFFAOYSA-N
SMILES:C(=NO)(C)C=1C=C2C(=CC1)OCCCO2
Synonyms:
  • Ethanone, 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-, oxime
  • 2H-1,5-Benzodioxepin, ethanone deriv.
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.