CAS 146328-85-0
:5-Bromo-2-fluorobenzoic acid
Description:
5-Bromo-2-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and fluorine substituents on the benzene ring. The bromine atom is located at the 5-position, while the fluorine atom is at the 2-position relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitution. The presence of halogens can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its unique substitution pattern may impart specific electronic and steric effects, which can be exploited in designing compounds with desired biological activities. Safety precautions should be taken when handling this compound, as with many halogenated organic substances.
Formula:C7H4BrFO2
InChI:InChI=1S/C7H4BrFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11)
InChI key:InChIKey=PEXAZYDITWXYNJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=CC(Br)=C1
Synonyms:- 2-Fluoro-5-Bromobenzoic Acid
- 5-Bromo-2-Fluoro-Benzoic Acid
- 5-Bromo-2-Fluorobenzoate
- 5-Bromo-2-fluorobenzoicacid
- Benzoic acid, 5-bromo-2-fluoro-
- Buttpark 19\01-67
- Rarechem Al Bo 0757
- 5-Bromo-2-fluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 5-bromo-2-fluoro-
CAS:Formula:C7H4BrFO2Purity:97%Color and Shape:SolidMolecular weight:219.0079Ref: IN-DA001DW0
1g21.00€5g25.00€10g27.00€1kgTo inquire25g37.00€100g83.00€10kgTo inquire25kgTo inquire500g225.00€5-Bromo-2-fluorobenzoic acid
CAS:5-Bromo-2-fluorobenzoic acidFormula:C7H4BrFO2Purity:97%Color and Shape: off white powderMolecular weight:219.01g/mol5-Bromo-2-fluorobenzoic Acid
CAS:Formula:C7H4BrFO2Purity:>97.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:219.015-Bromo-2-fluorobenzoic acid
CAS:Formula:C7H4BrFO2Purity:97%Color and Shape:SolidMolecular weight:219.0095-Bromo-2-fluorobenzoic acid
CAS:5-Bromo-2-fluorobenzoic acid is a potential drug that can be used to treat diseases such as malaria. It is also used in the synthesis of fluorine compounds, such as fluoroarenes. 5-Bromo-2-fluorobenzoic acid is activated by deprotonation with butyllithium and reacts with chlorine to give the product of 5-bromo-2-chlorobenzoic acid. The reagent chlorotrimethylsilane may also be used for this reaction. Substitution of fluorine for chlorine at the 2 position yields the desired product, 5-bromo-2-(trifluoromethyl)benzoic acid. This compound is a useful intermediate for making other drugs, including those that are important for treating cancer and viral infections.Formula:C7H4BrFO2Purity:Min. 95%Color and Shape:PowderMolecular weight:219.01 g/mol




