CAS 14633-22-8
:3-(1-Methylethyl)-5-isoxazolecarboxylic acid
Description:
3-(1-Methylethyl)-5-isoxazolecarboxylic acid, also known by its CAS number 14633-22-8, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, compounds with isoxazole moieties exhibit biological activity, making them of interest in pharmaceutical research. The compound may participate in various chemical reactions, including esterification and amidation, due to its carboxylic acid functionality. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, 3-(1-Methylethyl)-5-isoxazolecarboxylic acid represents a unique structure with potential utility in various chemical and biological contexts.
Formula:C7H9NO3
InChI:InChI=1S/C7H9NO3/c1-4(2)5-3-6(7(9)10)11-8-5/h3-4H,1-2H3,(H,9,10)
InChI key:InChIKey=GYOKWSOCMUDVGN-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C=C(C(O)=O)ON1
Synonyms:- 3-(1-Methylethyl)-5-isoxazolecarboxylic acid
- 3-(Propan-2-Yl)-1,2-Oxazole-5-Carboxylic Acid
- 5-Isoxazolecarboxylic acid, 3-(1-methylethyl)-
- 5-Isoxazolecarboxylic acid, 3-isopropyl-
- 5-Isoxazolecarboxylicacid,3-(1-methylethyl)-(9CI)
- 3-Isopropylisoxazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Isoxazolecarboxylic acid, 3-(1-methylethyl)-
CAS:Formula:C7H9NO3Purity:98%Color and Shape:SolidMolecular weight:155.15133-Isopropylisoxazole-5-carboxylic acid
CAS:3-Isopropylisoxazole-5-carboxylic acidPurity:98%Molecular weight:155.15g/mol3-Isopropyl-isoxazole-5-carboxylic acid
CAS:Formula:C7H9NO3Purity:95%Color and Shape:SolidMolecular weight:155.1533-Isopropylisoxazole-5-carboxylic acid
CAS:3-Isopropylisoxazole-5-carboxylic acid (3IPA) is an inhibitor of voltage-gated calcium channels. It has been shown to be effective in the treatment of neuropathic pain by reducing the excitability of neurons. 3IPA exhibits its analgesic properties through its binding to the t-type calcium channel, which is responsible for regulating the flow of calcium ions into cells. 3IPA also reduces neuronal excitability by inhibiting voltage-gated potassium channels and glutamate release. 3IPA may be a potential therapeutic agent for neuropathic pain, as it provides a novel approach to treating this type of pain.Formula:C7H9NO3Purity:Min. 95%Molecular weight:155.15 g/mol



