CAS 14633-54-6
:CYCLOPROPYL PHENYL SULFIDE
Description:
Cyclopropyl phenyl sulfide, with the CAS number 14633-54-6, is an organic compound characterized by the presence of a cyclopropyl group and a phenyl group connected by a sulfur atom. This compound typically exhibits a colorless to pale yellow liquid form and has a distinctive odor. It is known for its relatively low boiling point and moderate solubility in organic solvents, which makes it useful in various chemical applications. The presence of the sulfur atom contributes to its reactivity, allowing it to participate in nucleophilic substitution reactions. Cyclopropyl phenyl sulfide is often studied for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. Additionally, due to the unique strain in the cyclopropyl ring, it may exhibit interesting chemical behavior, including increased reactivity compared to more stable cyclic compounds. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C9H10S
InChI:InChI=1/C9H10S/c1-2-4-8(5-3-1)10-9-6-7-9/h1-5,9H,6-7H2
SMILES:c1ccc(cc1)SC1CC1
Synonyms:- (Cyclopropylsulfanyl)benzene
- Cyclopropyl Phenyl Sulphide
- Cyclopropyl phenyl sulfide, 98+%
- Cyclopropylthiobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cyclopropyl Phenyl Sulfide
CAS:Formula:C9H10SPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:150.24Cyclopropyl phenyl sulfide, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H10SPurity:98+%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:150.24Benzene, (cyclopropylthio)-
CAS:Formula:C9H10SPurity:98%Color and Shape:LiquidMolecular weight:150.2407Cyclopropyl phenyl sulphide
CAS:Cyclopropyl phenyl sulphideFormula:C9H10SPurity:≥95%Color and Shape: colourless liquidMolecular weight:150.24g/molCyclopropyl phenyl sulfide
CAS:Formula:C9H10SPurity:95%Color and Shape:No data available.Molecular weight:150.24




