CymitQuimica logo

CAS 146368-07-2

:

1-Ethyl-2,3,3-Trimethyl-Indoleninium-5-Sulfonate

Description:
1-Ethyl-2,3,3-Trimethyl-Indoleninium-5-Sulfonate is a chemical compound characterized by its indoleninium structure, which features a positively charged nitrogen atom within a five-membered aromatic ring. This compound is typically used in organic synthesis and as a dye or pigment due to its vibrant color properties. The presence of the sulfonate group enhances its solubility in polar solvents, making it useful in various applications, including as a reagent in chemical reactions and in the development of organic electronic materials. Its ethyl and trimethyl substituents contribute to its steric and electronic properties, influencing its reactivity and stability. Additionally, the compound may exhibit interesting photophysical properties, which can be exploited in photochemical applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, 1-Ethyl-2,3,3-Trimethyl-Indoleninium-5-Sulfonate is a versatile compound with applications in both research and industrial settings.
Formula:C13H17NO3S
InChI:InChI=1/C13H17NO3S/c1-5-14-9(2)13(3,4)11-8-10(18(15,16)17)6-7-12(11)14/h6-8H,5H2,1-4H3
InChI key:UQVWIROBIAWZFW-UHFFFAOYSA-N
SMILES:CC[N+]1=C(C)C(C)(C)c2cc(ccc12)[S-](=O)(=O)=O
Synonyms:
  • 1-ethyl-2,3,3-trimethyl-3H-indolium-5-sulfonate
Found 5 products.