CAS 146369-65-5
:H-TYR-TIC-PHE-PHE-OH
Description:
The chemical substance known as H-TYR-TIC-PHE-PHE-OH, with the CAS number 146369-65-5, is a peptide that consists of a sequence of amino acids, specifically tyrosine (Tyr), threonine (Tic), phenylalanine (Phe), and another phenylalanine (Phe) at the C-terminus. This compound is characterized by its structure, which includes a hydroxyl group (-OH) at the end, indicating it is a hydroxylated peptide. Peptides like H-TYR-TIC-PHE-PHE-OH are often studied for their biological activity, potential therapeutic applications, and role in various biochemical processes. The presence of aromatic amino acids, such as tyrosine and phenylalanine, suggests potential interactions with biological receptors or enzymes. Additionally, the specific sequence and modifications can influence the peptide's stability, solubility, and overall functionality in biological systems. Such peptides may be of interest in fields like pharmacology, biochemistry, and molecular biology for their potential roles in signaling pathways or as drug candidates.
Formula:C37H38N4O6
InChI:InChI=1/C37H38N4O6/c38-29(20-22-13-15-27(42)16-14-22)35(44)31(25-9-2-1-3-10-25)33(37(46)47)41-36(45)30(39)21-23-7-6-11-26(19-23)34(43)32-28-12-5-4-8-24(28)17-18-40-32/h1-5,7-10,12-18,26,29-31,33,42H,6,11,19-21,38-39H2,(H,41,45)(H,46,47)/t26-,29-,30-,31?,33-/m0/s1
SMILES:c1ccc(cc1)C([C@@H](C(=O)O)N=C([C@H](CC1=CCC[C@@H](C1)C(=O)c1c2ccccc2ccn1)N)O)C(=O)[C@H](Cc1ccc(cc1)O)N
Synonyms:- Tipp
- Tyrosyl-1,2,3,4-Tetrahydro-3-Isoquinolinecarbonyl-Phenylalanyl-Phenylalanine
- N-{[(3S)-2-(L-tyrosyl)-1,2,3,4-tetrahydroisoquinolin-3-yl]carbonyl}-L-phenylalanyl-L-phenylalanine
- 3-[(5S)-5-(isoquinolin-1-ylcarbonyl)cyclohex-1-en-1-yl]-L-alanyl-beta-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-L-phenylalanine
- TIPP H-Tyr-Tic-Phe-Phe-OH
- Tyr-tic-Phe-phe-OH
- H-TYR-TIC-PHE-PHE-OH
- L-Tyrosyl-L-1,2,3,4-tetrahydro-3-isoquinolinecarbonyl-L-phenylalanyl-L-phenylalanine
- L-Phenylalanine, L-tyrosyl-(3S)-1,2,3,4-tetrahydro-3-isoquinolinecarbonyl-L-phenylalanyl-
- L-Phenylalanine, L-tyrosyl-L-1,2,3,4-tetrahydro-3-isoquinolinecarbonyl-L-phenylalanyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
TIPP
CAS:TIPP is an agent of delta opioid antagonist.Formula:C37H38N4O6Purity:98%Color and Shape:SolidMolecular weight:634.72TIPP
CAS:TIPP is a peptide that belongs to the group of chemokines. It has been shown to have receptor binding activity and to stimulate the release of pro-inflammatory cytokines in cancer cells. TIPP interacts with membranes by forming hydrogen bonds with carbonyl groups and hydroxyl groups, which are located in the membrane. This results in a low energy barrier for intramolecular hydrogen transfer, making it a suitable candidate for drug design. TIPP also interacts with receptors, such as δ receptors, which may contribute to its anti-cancer properties.Formula:C37H38N4O6Purity:Min. 95%Molecular weight:634.72 g/mol

