CAS 146408-63-1: 3-Amino-4-chlorobenzoic acid tetradecyl ester
Description:3-Amino-4-chlorobenzoic acid tetradecyl ester is an organic compound characterized by its ester functional group, which is formed from the reaction of 3-amino-4-chlorobenzoic acid and tetradecanol. This compound features a benzoic acid core with an amino group and a chlorine atom substituent, contributing to its unique chemical properties. The tetradecyl ester portion indicates that it has a long hydrophobic alkyl chain, which can enhance its solubility in organic solvents and influence its biological activity. The presence of the amino and chloro groups may impart specific reactivity and potential interactions in biological systems. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as a surfactant, due to its amphiphilic nature. Its molecular structure suggests potential for interactions with biological membranes, making it a candidate for studies in drug delivery or as a biochemical probe. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of chlorine and amino functional groups.
Formula:C21H34ClNO2
InChI:InChI=1/C21H34ClNO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-25-21(24)18-14-15-19(22)20(23)17-18/h14-15,17H,2-13,16,23H2,1H3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Carbamic acid, (4-chlorophenyl)-, tetradecyl ester (9CI) REF: IN-DA001DZRCAS: 146408-63-1 | - - - | To inquire | Tue 29 Apr 25 |
![]() | 3-Amino-4-chlorobenzoic acid tetradecylester REF: 3D-FA150646CAS: 146408-63-1 | Min. 95% | - - - | Discontinued product |

Carbamic acid, (4-chlorophenyl)-, tetradecyl ester (9CI)
Ref: IN-DA001DZR
Undefined size | To inquire |

3-Amino-4-chlorobenzoic acid tetradecylester
Ref: 3D-FA150646
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |