CymitQuimica logo

CAS 1464137-20-9

:

(αR)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2H-tetrazole-5-propanoic acid

Description:
The chemical substance known as (αR)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2H-tetrazole-5-propanoic acid, with CAS number 1464137-20-9, is a synthetic compound that features a tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms. This compound is characterized by its unique structural components, including a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly used in peptide synthesis to protect amino groups. The presence of the propanoic acid moiety indicates that it possesses acidic properties, which can influence its solubility and reactivity. The stereochemistry denoted by (αR) suggests a specific spatial arrangement of atoms, which can be crucial for its biological activity. This compound may be of interest in medicinal chemistry and drug development due to its potential applications in peptide synthesis and as a building block for more complex molecules. Its stability, solubility, and reactivity would depend on the specific conditions under which it is handled and utilized.
Formula:C19H17N5O4
InChI:InChI=1S/C19H17N5O4/c25-18(26)16(9-17-21-23-24-22-17)20-19(27)28-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H,20,27)(H,25,26)(H,21,22,23,24)/t16-/m1/s1
InChI key:InChIKey=MZBYOFZABYTSQS-MRXNPFEDSA-N
SMILES:C(OC(N[C@H](CC=1NN=NN1)C(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • (αR)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2H-tetrazole-5-propanoic acid
  • 2H-Tetrazole-5-propanoic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (αR)-
Found 3 products.