CAS 146464-93-9
:4-[1-(2,4-Diamino-6-pteridinyl)-4-pentyn-2-yl]benzoic acid
Description:
4-[1-(2,4-Diamino-6-pteridinyl)-4-pentyn-2-yl]benzoic acid, with CAS number 146464-93-9, is a chemical compound that features a complex structure characterized by a benzoic acid moiety linked to a pteridinyl group. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties relevant to the development of pharmaceuticals. The presence of the pteridinyl ring suggests that it may interact with biological targets such as enzymes or receptors, potentially influencing metabolic pathways. The amino groups in the structure can participate in hydrogen bonding, enhancing solubility and reactivity. Additionally, the alkyne functional group (4-pentyn-2-yl) may provide sites for further chemical modification or conjugation, making it a versatile scaffold in drug design. Overall, this compound's unique structural features contribute to its potential applications in therapeutic contexts, although specific biological activities would require further investigation through experimental studies.
Formula:C18H16N6O2
InChI:InChI=1S/C18H16N6O2/c1-2-3-12(10-4-6-11(7-5-10)17(25)26)8-13-9-21-16-14(22-13)15(19)23-18(20)24-16/h1,4-7,9,12H,3,8H2,(H,25,26)(H4,19,20,21,23,24)
SMILES:C#CCC(Cc1cnc2c(c(N)[nH]c(=N)n2)n1)c1ccc(cc1)C(=O)O
Synonyms:- 10-Propargyl-4-deoxy-4-amino-10-deazapteroic acid
- Benzoic acid, 4-[1-[(2,4-diamino-6-pteridinyl)methyl]-3-butyn-1-yl]-
- 4-[1-[(2,4-diamino-6-pteridinyl)methyl]-3-butyn-1-yl]Benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-(1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl)benzoic acid
CAS:Formula:C18H16N6O2Purity:97%Molecular weight:348.35864-(1-(2,4-Diaminopteridin-6-yl)pent-4-yn-2-yl)benzoic acid
CAS:4-(1-(2,4-Diaminopteridin-6-yl)pent-4-yn-2-yl)benzoic acidPurity:97%Molecular weight:348.36g/mol4-(1-(2,4-Diaminopteridin-6-yl)pent-4-yn-2-yl)benzoic acid
CAS:Purity:97%Molecular weight:348.365997310-Propargyl-4-deoxy-4-amino-10-deazapteroic Acid
CAS:Controlled ProductFormula:C18H16N6O2Color and Shape:NeatMolecular weight:348.35910-Propargyl-4-deoxy-4-amino-10-deazapteroic Acid
CAS:<p>10-Propargyl-4-deoxy-4-amino-10-deazapteroic Acid is a synthetic compound that is hydrolyzed to form the active drug Pralatrexate. It is a prodrug of Pralatrexate, which inhibits DNA synthesis and repair, causing cell death by apoptosis or necrosis. 10-Propargyl-4-deoxy-4-amino-10-deazapteroic Acid has shown to be effective against leukemia cells in vitro and in vivo.</p>Formula:C18H16N6O2Purity:Min. 95%Molecular weight:348.36 g/mol






