CAS 146475-54-9
:N,N-Dimethyl-cyclopropanesulfonamide
Description:
N,N-Dimethyl-cyclopropanesulfonamide is an organic compound characterized by its sulfonamide functional group attached to a cyclopropane ring. This compound features two methyl groups attached to the nitrogen atom, which contributes to its dimethyl designation. The cyclopropane structure introduces unique strain and reactivity due to its three-membered ring configuration. Typically, sulfonamides are known for their antibacterial properties, although the specific biological activity of N,N-Dimethyl-cyclopropanesulfonamide may vary. The compound is likely to be a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group. Its chemical properties, such as reactivity and stability, can be influenced by the steric effects of the dimethyl groups and the inherent strain of the cyclopropane ring. As with many sulfonamides, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry and potential pharmaceutical applications.
Formula:C5H11NO2S
InChI:InChI=1/C5H11NO2S/c1-6(2)9(7,8)5-3-4-5/h5H,3-4H2,1-2H3
SMILES:CN(C)S(=O)(=O)C1CC1
Synonyms:- N,N-Dimethyl Cyclopropanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
