CAS 14648-57-8

2-Ethyl-2-adamantanol

Description:

2-Ethyl-2-adamantanol is a chemical compound characterized by its unique structure derived from adamantane, a polycyclic hydrocarbon. It features an alcohol functional group (-OH) attached to the second carbon of the adamantane framework, along with an ethyl group at the same carbon, which contributes to its classification as a tertiary alcohol. This compound is typically a white crystalline solid at room temperature and is known for its relatively high melting point and low volatility. Its molecular structure imparts notable stability and hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. 2-Ethyl-2-adamantanol has potential applications in organic synthesis and as a building block in the development of pharmaceuticals and other chemical products. Additionally, its unique steric properties may influence its reactivity and interactions in various chemical reactions, making it a subject of interest in both academic and industrial research. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₂₀O

InChI: InChI=1/C12H20O/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8/h8-11,13H,2-7H2,1H3

SMILES: CCC1(C2CC3CC(C2)CC1C3)O

Synonyms:

• 2-Ethyltricyclo[3.3.1.1~3,7~]Decan-2-Ol

2-Ethyl-2-adamantanol

CAS: 14648-57-8

Formula: C₁₂H₂₀O

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystaline

Molecular weight: 180.29

Ref: 3B-E0659

Tricyclo[3.3.1.13,7]decan-2-ol, 2-ethyl-

CAS: 14648-57-8

Formula: C₁₂H₂₀O

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.2866

Ref: IN-DA001E2K

2-Ethyl-2-hydroxyadamantane

CAS: 14648-57-8

2-Ethyl-2-hydroxyadamantane

Purity: 98%

Molecular weight: 180.29g/mol

Ref: 54-OR41027

2-Ethyl-2-adamantanol

CAS: 14648-57-8

2-Ethyl-2-adamantanol is a polymerization inhibitor that can be used to prevent the formation of polymers. 2-Ethyl-2-adamantanol inhibits the reaction by reacting with chloride, preventing the formation of a covalent bond. This inhibition is reversible and does not affect other reactions. The use of 2-ethyl-2-adamantanol as an inhibitor has been shown to increase the reaction yield when using bromoethane as a feedstock. It also increases the selectivity for ethyl groups in this process, making it an excellent choice for synthesizing lanthanides.

Formula: C₁₂H₂₀O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 180.29 g/mol

Ref: 3D-FE03871

2-Ethyladamantan-2-ol

CAS: 14648-57-8

Formula: C₁₂H₂₀O

Purity: 98%

Molecular weight: 180.291

Ref: 10-F463078