CAS 146502-80-9
:(-)-(1R,2R,5S)-neomenthyl acetate
Description:
(-)-(1R,2R,5S)-neomenthyl acetate is an organic compound belonging to the class of esters, specifically derived from neomenthol and acetic acid. It is characterized by its chiral structure, which contributes to its unique sensory properties, often described as having a pleasant, minty aroma. This compound is typically colorless to pale yellow in appearance and is known for its volatility, making it useful in the fragrance and flavor industries. Its molecular formula reflects the presence of carbon, hydrogen, and oxygen atoms, which are arranged in a way that imparts specific physical and chemical properties. (-)-(1R,2R,5S)-neomenthyl acetate is soluble in organic solvents and exhibits low solubility in water, which is common for many esters. Additionally, it may possess certain biological activities, although its primary applications are in perfumery and food flavoring. As with many chemical substances, safety data sheets should be consulted for handling and exposure guidelines.
Formula:C12H22O2
InChI:InChI=1/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12+/m0/s1
Synonyms:- (1R)-()-Neomenthyl acetate
- (1R,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexyl acetate
- (1R,2R,5S)-()-Neomenthyl acetate
- NEOMENTHYLACETATE, (1R)-(-)-(RG)
- Cyclohexanol, 5-methyl-2-(1-methylethyl)-, 1-acetate, (1R,2R,5S)-
- (-)-(1R,2R,5S)-NEOMENTHYL ACETATE, TERPE NE STANDARD
- NEOMENTHYLACETATE, (1R)-(-)-
- (-)-Neomenthyl Acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Cyclohexanol, 5-methyl-2-(1-methylethyl)-, 1-acetate, (1R,2R,5S)-
CAS:Formula:C12H22O2Molecular weight:198.3019(-)-Neomenthyl Acetate
CAS:Controlled ProductFormula:C12H22O2Color and Shape:NeatMolecular weight:198.30


