CAS 146552-71-8
:Carbamic acid, [(1S)-2-amino-1-methylethyl]-, 1,1-dimethylethyl ester
Description:
Carbamic acid, [(1S)-2-amino-1-methylethyl]-, 1,1-dimethylethyl ester, also known by its CAS number 146552-71-8, is an organic compound characterized by its carbamate functional group. This substance features a chiral center, which contributes to its stereochemistry, specifically the (1S) configuration. It is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. The compound is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various biologically active molecules. Its structure includes an amino group, which can participate in hydrogen bonding, enhancing its reactivity and interaction with other chemical species. Additionally, the presence of the tert-butyl ester group contributes to its stability and lipophilicity, making it suitable for various chemical reactions. Safety data indicates that, like many carbamates, it should be handled with care due to potential toxicity and environmental impact.
Formula:C8H18N2O2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Carbamic acid, N-[(1S)-2-amino-1-methylethyl]-, 1,1-dimethylethyl ester
CAS:Formula:C8H18N2O2Purity:95%Color and Shape:SolidMolecular weight:174.2407Ref: IN-DA001E56
1g99.00€5g233.00€10g572.00€25gTo inquire50gTo inquire100gTo inquire250gTo inquire100mg31.00€250mg50.00€(S)-2-N-Boc-propane-1,2-diamine
CAS:(S)-2-N-Boc-propane-1,2-diaminePurity:95%Molecular weight:174.24072g/mol(S)-TERT-BUTYL 1-AMINOPROPAN-2-YLCARBAMATE
CAS:Formula:C8H18N2O2Purity:95%Color and Shape:SolidMolecular weight:174.244


