CAS 14657-64-8
:3-Hydroxyphenylphosphinyl-propanoic acid
Description:
3-Hydroxyphenylphosphinyl-propanoic acid, with the CAS number 14657-64-8, is an organophosphorus compound characterized by the presence of a phosphinyl group attached to a propanoic acid moiety and a hydroxyl-substituted phenyl ring. This compound typically exhibits properties associated with both phosphorous and carboxylic acid functionalities, which may include moderate solubility in polar solvents and potential reactivity with nucleophiles due to the electrophilic nature of the phosphorus atom. The hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its interactions in biological systems or chemical reactions. Additionally, the presence of the phenyl ring may impart aromatic stability and influence the compound's electronic properties. Such compounds are often studied for their applications in agriculture, particularly as herbicides or plant growth regulators, due to their ability to interact with biological pathways. Safety and handling precautions are essential, as organophosphorus compounds can exhibit toxicity depending on their structure and concentration.
Formula:C9H11O4P
InChI:InChI=1S/C9H11O4P/c10-9(11)6-7-14(12,13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)(H,12,13)
InChI key:InChIKey=MORLYCDUFHDZKO-UHFFFAOYSA-N
SMILES:P(CCC(O)=O)(=O)(O)C1=CC=CC=C1
Synonyms:- 2-Carboxyethyl(phenyl)phosphinic acid
- 2-Carboxyethyl(phenyl)phosphinicacid
- 2-Carboxyl Ethyl(Phenyl) Phosphinic Acid
- 2-Carboxylethyl(phenyl)phosphinic acid
- 3-(Hydroxyphenylphosphinyl)propionic acid
- 3-(Hydroxyphenylphosphinyl)propionsure
- 3-(Phenylphosphinyl)propionic acid
- 3-Hpp
- 3-Hydroxyphenylphosphinyl-Prop
- 3-[Hydroxy(Phenyl)Phosphoryl]Propanoic Acid
- Ceppa
- H 205
- H 205 (flame retardant)
- Hiretar 205
- Phosgard PF 100
- Propanoic acid, 3-(hydroxyphenylphosphinyl)-
- Propionic acid, 3-(hydroxyphenylphosphinyl)-
- Pz 1201
- 3-(Hydroxyphenylphosphinyl)propanoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2-Carboxyethyl)phenylphosphinic Acid
CAS:Formula:C9H11O4PPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:214.16Propanoic acid, 3-(hydroxyphenylphosphinyl)-
CAS:Formula:C9H11O4PPurity:97%Color and Shape:SolidMolecular weight:214.15503-(Hydroxy(phenyl)phosphoryl)propanoic acid
CAS:3-(Hydroxy(phenyl)phosphoryl)propanoic acidPurity:99%Molecular weight:214.16g/mol2-Carboxyethyl phenyl phosphinic acid
CAS:2-Carboxyethyl phenyl phosphinic acid is a glycol ester that is used as a retardant and chlorine scavenger in the production of polyvinyl chloride. It reacts with metal ions to form insoluble metal salts, which prevents the formation of bubbles in the polymer film. 2-Carboxyethyl phenyl phosphinic acid has been shown to be soluble in aqueous media at pH values less than 7. When it is dissolved in water, it interacts with other substances to form complexes, such as solubility data, experimental solubility data, and solubility data. The average particle diameter of this compound is approximately 1 nm.Formula:C9H11O4PPurity:Min. 95%Color and Shape:White PowderMolecular weight:214.16 g/mol3-(Hydroxy(phenyl)phosphoryl)propanoic acid
CAS:Formula:C9H11O4PPurity:97%Color and Shape:SolidMolecular weight:214.157




