CymitQuimica logo

CAS 146578-65-6

:

10,11-dihydroxy-N-(n-3-fluoropropyl)norapomorphine

Description:
10,11-Dihydroxy-N-(n-3-fluoropropyl)norapomorphine is a synthetic compound that belongs to the class of norapomorphine derivatives, which are known for their potential pharmacological effects. This substance features a complex molecular structure characterized by the presence of two hydroxyl (-OH) groups at the 10 and 11 positions, contributing to its polarity and potential interactions with biological systems. The N-(n-3-fluoropropyl) moiety indicates the presence of a fluorinated alkyl chain, which can influence the compound's lipophilicity and receptor binding properties. The fluorine atom may enhance metabolic stability and alter the pharmacokinetics of the molecule. As a derivative of norapomorphine, this compound may exhibit activity at dopamine receptors, making it of interest in neuropharmacology and potential therapeutic applications. However, detailed studies on its biological activity, toxicity, and pharmacodynamics are essential to fully understand its characteristics and potential uses in medicinal chemistry.
Formula:C19H20FNO2
InChI:InChI=1/C19H20FNO2/c20-8-2-9-21-10-7-12-3-1-4-14-17(12)15(21)11-13-5-6-16(22)19(23)18(13)14/h1,3-6,15,22-23H,2,7-11H2/t15-/m1/s1
SMILES:c1cc2CCN(CCCF)[C@@H]3Cc4ccc(c(c4c(c1)c23)O)O
Synonyms:
  • Fnpa-10,11
  • (6aR)-6-(3-fluoropropyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.