CAS 146603-99-8
:1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) 4-ethyl ester
Description:
1,4-Piperidinedicarboxylic acid, 4-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) 4-ethyl ester, identified by CAS number 146603-99-8, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features two carboxylic acid functional groups, contributing to its acidity and potential reactivity. The presence of a propenyl group and a tert-butyl substituent indicates that it has aliphatic and unsaturated characteristics, which may influence its physical properties and reactivity. The ethyl ester moiety suggests that it can undergo hydrolysis to yield the corresponding acid. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, melting point, and other physical properties would depend on the specific conditions and the presence of functional groups. Overall, this compound's unique structure and functional groups make it a candidate for various applications in organic synthesis and pharmaceuticals.
Formula:C10H15NO4
InChI:InChI=1/C10H15NO4/c1-2-3-10(8(12)13)4-6-11(7-5-10)9(14)15/h2H,1,3-7H2,(H,12,13)(H,14,15)
SMILES:C=CCC1(CCN(CC1)C(=O)O)C(=O)O
Synonyms:- 4-Allylpiperidine-1,4-Dicarboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-tert-Butyl 4-ethyl 4-allylpiperidine-1,4-dicarboxylate
CAS:Formula:C16H27NO4Purity:95%Color and Shape:SolidMolecular weight:297.3899Ethyl 1-Boc-4-Allyl-4-Piperidinecarboxylate
CAS:Ethyl 1-Boc-4-Allyl-4-PiperidinecarboxylatePurity:≥95%Molecular weight:297.39g/molEthyl1-boc-4-allyl-4-piperidinecarboxylate
CAS:Ethyl1-boc-4-allyl-4-piperidinecarboxylate is a reagent, high quality, complex compound, useful intermediate, fine chemical, useful scaffold, useful building block, speciality chemical and research chemicals. It is used as a versatile building block for synthesis of drugs. Ethyl1-boc-4-allyl-4-piperidinecarboxylate is also used in reactions to synthesize new compounds with varied structures and properties. This product can be used in the production of various types of pharmaceuticals and other chemical products.Formula:C16H27NO4Purity:Min. 95%Molecular weight:297.39 g/mol1-tert-Butyl 4-ethyl 4-allylpiperidine-1,4-dicarboxylate
CAS:Formula:C16H27NO4Purity:95%Color and Shape:LiquidMolecular weight:297.395



