CymitQuimica logo

CAS 14663-28-6

:

1-({(E)-[5-(4-aminophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione

Description:
1-({(E)-[5-(4-aminophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione, with CAS number 14663-28-6, is a chemical compound characterized by its complex structure, which includes an imidazolidine ring and a furan moiety. This compound features a substituted imidazolidine core, which contributes to its potential biological activity. The presence of the furan ring and the amino group on the phenyl substituent suggests that it may exhibit interesting pharmacological properties, possibly acting as a bioactive molecule. The E configuration of the double bond in the side chain indicates a specific geometric arrangement that can influence its reactivity and interactions with biological targets. Additionally, the imidazolidine-2,4-dione structure implies the potential for tautomerism and hydrogen bonding, which can affect solubility and stability. Overall, this compound's unique structural features may make it a candidate for further research in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways or diseases.
Formula:C14H12N4O3
InChI:InChI=1/C14H12N4O3/c15-10-3-1-9(2-4-10)12-6-5-11(21-12)7-16-18-8-13(19)17-14(18)20/h1-7H,8,15H2,(H,17,19,20)/b16-7+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.