CAS 146631-00-7
:4-Benzyloxybenzeneboronic acid
Description:
4-Benzyloxybenzeneboronic acid, with the CAS number 146631-00-7, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a biphenyl structure. This compound features a benzyl ether group, which enhances its solubility and reactivity in various organic reactions. It typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethanol, but less soluble in water. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. Additionally, it can act as a ligand in coordination chemistry and has potential applications in medicinal chemistry due to its ability to interact with biological targets. The compound's stability and reactivity can be influenced by factors such as pH and the presence of other functional groups, making it a versatile building block in synthetic organic chemistry.
Formula:C13H13BO3
InChI:InChI=1/C13H13BO3/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11/h1-9,15-16H,10H2
SMILES:c1ccc(cc1)COc1ccc(cc1)B(O)O
Synonyms:- 4-Benzyloxyphenylboronic acid
- 4-(Benzyloxy)-benzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Benzyloxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C13H13BO3Purity:min. 90.0 %Color and Shape:White to Light yellow to Dark green powder to crystalMolecular weight:228.05(4-(Benzyloxy)phenyl)boronic acid
CAS:Formula:C13H13BO3Purity:98%Color and Shape:SolidMolecular weight:228.05154-(Benzyloxy)benzeneboronic acid
CAS:4-(Benzyloxy)benzeneboronic acidFormula:C13H13BO3Purity:98%Color and Shape: faint beige crystalline solidMolecular weight:228.05g/mol4-Benzyloxyphenylboronic acid
CAS:Formula:C13H13BO3Purity:98%Color and Shape:SolidMolecular weight:228.054-Benzyloxy-Phenylboronic Acid extrapure, 97%
CAS:Formula:C13H13BO3Purity:min. 97%Color and Shape:White to off white to pale yellow, Crystalline powderMolecular weight:228.05





