CAS 146632-07-7
:1,3-Bis(3-methacryloxypropyl)tetramethyldisiloxane
Description:
1,3-Bis(3-methacryloxypropyl)tetramethyldisiloxane, with CAS number 146632-07-7, is a siloxane compound characterized by its unique structure that incorporates both siloxane and methacrylate functionalities. This compound typically exhibits a low viscosity, making it suitable for various applications in polymer chemistry and materials science. The presence of methacrylate groups allows for easy polymerization, enabling the formation of cross-linked networks when exposed to UV light or heat, which is advantageous in coatings, adhesives, and sealants. Additionally, the siloxane backbone imparts flexibility, thermal stability, and resistance to moisture, enhancing the durability of the resulting materials. Its chemical reactivity, combined with the advantageous properties of siloxanes, makes it a valuable component in the formulation of advanced materials, particularly in the fields of dental materials, silicone elastomers, and other specialty polymers. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C18H34O5Si2
InChI:InChI=1/C18H34O5Si2/c1-15(2)17(19)21-11-9-13-24(5,6)23-25(7,8)14-10-12-22-18(20)16(3)4/h1,3,9-14H2,2,4-8H3
SMILES:C=C(C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(=C)C
Synonyms:- 2-Propenoic acid, 2-methyl-, 1,1'-((1,1,3,3-tetramethyl-1,3-disiloxanediyl)di-3,1-propanediyl) ester
- 1,3-Bis(3-methacryloyloxypropyl)tetramethyldisiloxane
- (1,1,3,3-Tetramethyldisiloxane-1,3-diyl)dipropane-1,3-diyl dimethacrylate
- 2-Propenoic acid, 2-methyl-, (1,1,3,3-tetramethyl-1,3-disiloxanediyl)di-3,1-propanediyl ester
- (1,1,3,3-Tetramethyldisiloxane-1,3-Diyl)Dipropane-3,1-Diyl Bis(2-Methylprop-2-Enoate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Monomethacryloxypropylterminated polydimethylsiloxane - asymmetric cSt 150-200 inhibited with BHT
CAS:Color and Shape:LiquidMolecular weight:0.0MonoMethacryloxypropyl terminated polydimethylsiloxane asymmetric 50-80Cst
CAS:Color and Shape:Liquid, ClearMolecular weight:0.0Monomethacryloxypropyl terminated polydimethylsiloxanes - asymmetric 6-9cSt
CAS:Color and Shape:Liquid, ClearMolecular weight:0.0monoMETHACRYLOXYPROPYL TERMINATED POLYDIMETHYLSILOXANE, asymmetric, 10 cSt
CAS:Color and Shape:Deep Straw LiquidMolecular weight:1000.0monoMETHACRYLOXYPROPYL TERMINATED POLYDIMETHYLSILOXANE, asymmetric, 6-9 cSt
CAS:Color and Shape:Deep Straw LiquidMolecular weight:600-800monoMETHACRYLOXYPROPYL TERMINATED POLYDIMETHYLSILOXANE, asymmetric, 70-80 cSt
CAS:Color and Shape:LiquidMolecular weight:5000.0MonoMethacryloxypropyl terminated polydimethylsiloxane - asymmetric cSt10
CAS:Color and Shape:LiquidMolecular weight:0.0Monomethacryloxypropylterminatedpolydimethylsiloxanes
CAS:<p>Please enquire for more information about Monomethacryloxypropylterminatedpolydimethylsiloxanes including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C12H26O4Si2Purity:Min. 95%Molecular weight:290.5 g/mol


